About N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide
N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide (PubChem CID 10736297) has the molecular formula C17H19N3O3S
and a molecular weight of 345.42 g/mol. Its IUPAC name is N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide |
| PubChem CID | 10736297 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide |
| SMILES | CCSc1c(C)on(C(=O)N(c2ccc(C#N)cc2)C(C)C)c1=O |
| InChI | InChI=1S/C17H19N3O3S/c1-5-24-15-12(4)23-20(16(15)21)17(22)19(11(2)3)14-8-6-13(10-18)7-9-14/h6-9,11H,5H2,1-4H3 |
| InChIKey | QDHMNMCNLJZEJP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide?
The IUPAC name of N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide (CID 10736297) is N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide.
What is the SMILES notation for N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide?
The canonical SMILES for N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide is CCSc1c(C)on(C(=O)N(c2ccc(C#N)cc2)C(C)C)c1=O.
What is the InChIKey of N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide?
The InChIKey is QDHMNMCNLJZEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3S/c1-5-24-15-12(4)23-20(16(15)21)17(22)19(11(2)3)14-8-6-13(10-18)7-9-14/h6-9,11H,5H2,1-4H3.
What are the key properties of N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide?
N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide has a molecular weight of 345.42 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyanophenyl)-4-ethylsulfanyl-5-methyl-3-oxo-N-propan-2-yl-1,2-oxazole-2-carboxamide is sourced from PubChem (CID 10736297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).