About 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate
3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate (PubChem CID 107363382) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate |
| PubChem CID | 107363382 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate |
| SMILES | CC(C)C(C)OC(=O)c1cc2cc(N)ccc2[nH]1 |
| InChI | InChI=1S/C14H18N2O2/c1-8(2)9(3)18-14(17)13-7-10-6-11(15)4-5-12(10)16-13/h4-9,16H,15H2,1-3H3 |
| InChIKey | ZCLDTXXHQJFZEP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate?
The IUPAC name of 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate (CID 107363382) is 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate.
What is the SMILES notation for 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate?
The canonical SMILES for 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate is CC(C)C(C)OC(=O)c1cc2cc(N)ccc2[nH]1.
What is the InChIKey of 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate?
The InChIKey is ZCLDTXXHQJFZEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-8(2)9(3)18-14(17)13-7-10-6-11(15)4-5-12(10)16-13/h4-9,16H,15H2,1-3H3.
What are the key properties of 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate?
3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate has a molecular weight of 246.31 g/mol, XLogP of 2.95, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl 5-amino-1H-indole-2-carboxylate is sourced from PubChem (CID 107363382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).