C18H18O7 — CID 10736339
(9bS)-2-acetyl-3,7,9-trihydroxy-6-(1-hydroxyethyl)-8,9b-dimethyldibenzofuran-1-one (PubChem CID 10736339) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is (9bS)-2-acetyl-3,7,9-trihydroxy-6-(1-hydroxyethyl)-8,9b-dimethyldibenzofuran-1-one.
| Compound Name | (9bS)-2-acetyl-3,7,9-trihydroxy-6-(1-hydroxyethyl)-8,9b-dimethyldibenzofuran-1-one |
|---|---|
| PubChem CID | 10736339 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (9bS)-2-acetyl-3,7,9-trihydroxy-6-(1-hydroxyethyl)-8,9b-dimethyldibenzofuran-1-one |
| SMILES | CC(=O)C1=C(O)C=C2Oc3c(C(C)O)c(O)c(C)c(O)c3[C@]2(C)C1=O |
| InChI | InChI=1S/C18H18O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,8,20-23H,1-4H3/t8?,18-/m1/s1 |
| InChIKey | ILXUFRXSKKCWNA-MDNBJBEASA-N |
| XLogP | 1.98 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|