C14H11Cl3FN — CID 107363878
3-chloro-N-[1-(3,4-dichlorophenyl)ethyl]-5-fluoroaniline (PubChem CID 107363878) has the molecular formula C14H11Cl3FN and a molecular weight of 318.61 g/mol. Its IUPAC name is 3-chloro-N-[1-(3,4-dichlorophenyl)ethyl]-5-fluoroaniline.
| Compound Name | 3-chloro-N-[1-(3,4-dichlorophenyl)ethyl]-5-fluoroaniline |
|---|---|
| PubChem CID | 107363878 |
| Molecular Formula | C14H11Cl3FN |
| Molecular Weight | 318.61 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | 3-chloro-N-[1-(3,4-dichlorophenyl)ethyl]-5-fluoroaniline |
| SMILES | CC(Nc1cc(F)cc(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H11Cl3FN/c1-8(9-2-3-13(16)14(17)4-9)19-12-6-10(15)5-11(18)7-12/h2-8,19H,1H3 |
| InChIKey | KQSVOMNOJSNBOJ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |