C15H8ClFN4OS — CID 10736389
N-(4-chlorophenyl)-2-(3-fluorophenyl)-[1,2,4]thiadiazolo[3,2-b][1,3,4]oxadiazol-6-imine (PubChem CID 10736389) has the molecular formula C15H8ClFN4OS and a molecular weight of 346.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(3-fluorophenyl)-[1,2,4]thiadiazolo[3,2-b][1,3,4]oxadiazol-6-imine.
| Compound Name | N-(4-chlorophenyl)-2-(3-fluorophenyl)-[1,2,4]thiadiazolo[3,2-b][1,3,4]oxadiazol-6-imine |
|---|---|
| PubChem CID | 10736389 |
| Molecular Formula | C15H8ClFN4OS |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | N-(4-chlorophenyl)-2-(3-fluorophenyl)-[1,2,4]thiadiazolo[3,2-b][1,3,4]oxadiazol-6-imine |
| SMILES | Fc1cccc(-c2nn3s/c(=N\c4ccc(Cl)cc4)nc3o2)c1 |
| InChI | InChI=1S/C15H8ClFN4OS/c16-10-4-6-12(7-5-10)18-14-19-15-21(23-14)20-13(22-15)9-2-1-3-11(17)8-9/h1-8H/b18-14- |
| InChIKey | WGIQCPRIVJVIPQ-JXAWBTAJSA-N |
| XLogP | 4.08 |
| TPSA | 55.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|