C19H31NO3Si — CID 10736558
(4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile (PubChem CID 10736558) has the molecular formula C19H31NO3Si and a molecular weight of 349.55 g/mol. Its IUPAC name is (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile.
| Compound Name | (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile |
|---|---|
| PubChem CID | 10736558 |
| Molecular Formula | C19H31NO3Si |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carbonitrile |
| SMILES | CC1C=C(O[Si](C)(C)C(C)(C)C)C[C@H]2OC(C)(C)CC(=O)[C@@]12C#N |
| InChI | InChI=1S/C19H31NO3Si/c1-13-9-14(23-24(7,8)17(2,3)4)10-16-19(13,12-20)15(21)11-18(5,6)22-16/h9,13,16H,10-11H2,1-8H3/t13?,16-,19-/m1/s1 |
| InChIKey | UICBPAHCNSRTHQ-FDMCOVCTSA-N |
| XLogP | 4.58 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|