About N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide
N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide (PubChem CID 10736566) has the molecular formula C10H15IN4O2
and a molecular weight of 350.16 g/mol. Its IUPAC name is N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide |
| PubChem CID | 10736566 |
| Molecular Formula | C10H15IN4O2 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide |
| SMILES | C/C(=N\c1c(I)c(=O)n(C)c(=O)n1C)N(C)C |
| InChI | InChI=1S/C10H15IN4O2/c1-6(13(2)3)12-8-7(11)9(16)15(5)10(17)14(8)4/h1-5H3/b12-6+ |
| InChIKey | HAYVCCYELZNLFV-WUXMJOGZSA-N |
| XLogP | 0.30 |
| TPSA | 59.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide?
The IUPAC name of N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide (CID 10736566) is N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide.
What is the SMILES notation for N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide?
The canonical SMILES for N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide is C/C(=N\c1c(I)c(=O)n(C)c(=O)n1C)N(C)C.
What is the InChIKey of N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide?
The InChIKey is HAYVCCYELZNLFV-WUXMJOGZSA-N. The full InChI is InChI=1S/C10H15IN4O2/c1-6(13(2)3)12-8-7(11)9(16)15(5)10(17)14(8)4/h1-5H3/b12-6+.
What are the key properties of N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide?
N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide has a molecular weight of 350.16 g/mol, XLogP of 0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-iodo-1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylethanimidamide is sourced from PubChem (CID 10736566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).