About [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol
[2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol (PubChem CID 10736591) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol.
Molecular Properties
| Compound Name | [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol |
| PubChem CID | 10736591 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol |
| SMILES | CC1(CO)COC(c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)OC1 |
| InChI | InChI=1S/C21H22N2O3/c1-21(12-24)13-25-20(26-14-21)19-22-17(15-8-4-2-5-9-15)18(23-19)16-10-6-3-7-11-16/h2-11,20,24H,12-14H2,1H3,(H,22,23) |
| InChIKey | WTRKWLHEIVJAHM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol?
The IUPAC name of [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol (CID 10736591) is [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol.
What is the SMILES notation for [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol?
The canonical SMILES for [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol is CC1(CO)COC(c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)OC1.
What is the InChIKey of [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol?
The InChIKey is WTRKWLHEIVJAHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3/c1-21(12-24)13-25-20(26-14-21)19-22-17(15-8-4-2-5-9-15)18(23-19)16-10-6-3-7-11-16/h2-11,20,24H,12-14H2,1H3,(H,22,23).
What are the key properties of [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol?
[2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol has a molecular weight of 350.42 g/mol, XLogP of 3.79, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,5-diphenyl-1H-imidazol-2-yl)-5-methyl-1,3-dioxan-5-yl]methanol is sourced from PubChem (CID 10736591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).