C20H19NO5 — CID 10736770
1,3,8-trihydroxy-6-methyl-2-piperidin-1-ylanthracene-9,10-dione (PubChem CID 10736770) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 1,3,8-trihydroxy-6-methyl-2-piperidin-1-ylanthracene-9,10-dione.
| Compound Name | 1,3,8-trihydroxy-6-methyl-2-piperidin-1-ylanthracene-9,10-dione |
|---|---|
| PubChem CID | 10736770 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1,3,8-trihydroxy-6-methyl-2-piperidin-1-ylanthracene-9,10-dione |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1cc(O)c(N3CCCCC3)c(O)c1C2=O |
| InChI | InChI=1S/C20H19NO5/c1-10-7-11-15(13(22)8-10)19(25)16-12(18(11)24)9-14(23)17(20(16)26)21-5-3-2-4-6-21/h7-9,22-23,26H,2-6H2,1H3 |
| InChIKey | MVHUAHVNEFVAGP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|