3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid

C10H13N3O4 — CID 107368983

IUPAC3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid
SMILESCN1CCN(C(=O)c2cc(C(=O)O)on2)CC1
InChIInChI=1S/C10H13N3O4/c1-12-2-4-13(5-3-12)9(14)7-6-8(10(15)16)17-11-7/h6H,2-5H2,1H3,(H,15,16)
InChIKeySSKRJQYZNBGETI-UHFFFAOYSA-N
MW239.23 g/mol
LogP-0.24
Rot. Bonds2

About 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid

3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 107368983) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid
PubChem CID107368983
Molecular FormulaC10H13N3O4
Molecular Weight239.23 g/mol
Exact Mass239.09
IUPAC Name3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid
SMILESCN1CCN(C(=O)c2cc(C(=O)O)on2)CC1
InChIInChI=1S/C10H13N3O4/c1-12-2-4-13(5-3-12)9(14)7-6-8(10(15)16)17-11-7/h6H,2-5H2,1H3,(H,15,16)
InChIKeySSKRJQYZNBGETI-UHFFFAOYSA-N
XLogP-0.24
TPSA86.88 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.23
LogP ≤ 5-0.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid (CID 107368983) is 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid is CN1CCN(C(=O)c2cc(C(=O)O)on2)CC1.
What is the InChIKey of 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid?
The InChIKey is SSKRJQYZNBGETI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O4/c1-12-2-4-13(5-3-12)9(14)7-6-8(10(15)16)17-11-7/h6H,2-5H2,1H3,(H,15,16).
What are the key properties of 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid?
3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid has a molecular weight of 239.23 g/mol, XLogP of -0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylpiperazine-1-carbonyl)-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 107368983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).