C17H21N7O2 — CID 10736912
4-methyl-2-[4-[(6-pyrazol-1-yl-2-pyridinyl)methylamino]butyl]-1,2,4-triazine-3,5-dione (PubChem CID 10736912) has the molecular formula C17H21N7O2 and a molecular weight of 355.40 g/mol. Its IUPAC name is 4-methyl-2-[4-[(6-pyrazol-1-yl-2-pyridinyl)methylamino]butyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 4-methyl-2-[4-[(6-pyrazol-1-yl-2-pyridinyl)methylamino]butyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 10736912 |
| Molecular Formula | C17H21N7O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 4-methyl-2-[4-[(6-pyrazol-1-yl-2-pyridinyl)methylamino]butyl]-1,2,4-triazine-3,5-dione |
| SMILES | Cn1c(=O)cnn(CCCCNCc2cccc(-n3cccn3)n2)c1=O |
| InChI | InChI=1S/C17H21N7O2/c1-22-16(25)13-20-24(17(22)26)10-3-2-8-18-12-14-6-4-7-15(21-14)23-11-5-9-19-23/h4-7,9,11,13,18H,2-3,8,10,12H2,1H3 |
| InChIKey | LNEJMANYBRPGTJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|