3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid

C12H7N3O4 — CID 107369142

IUPAC3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
SMILESN#Cc1ccccc1NC(=O)c1cc(C(=O)O)on1
InChIInChI=1S/C12H7N3O4/c13-6-7-3-1-2-4-8(7)14-11(16)9-5-10(12(17)18)19-15-9/h1-5H,(H,14,16)(H,17,18)
InChIKeyJOISVDGNQSFPCA-UHFFFAOYSA-N
MW257.21 g/mol
LogP1.50
Rot. Bonds3

About 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid

3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 107369142) has the molecular formula C12H7N3O4 and a molecular weight of 257.21 g/mol. Its IUPAC name is 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
PubChem CID107369142
Molecular FormulaC12H7N3O4
Molecular Weight257.21 g/mol
Exact Mass257.04
IUPAC Name3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
SMILESN#Cc1ccccc1NC(=O)c1cc(C(=O)O)on1
InChIInChI=1S/C12H7N3O4/c13-6-7-3-1-2-4-8(7)14-11(16)9-5-10(12(17)18)19-15-9/h1-5H,(H,14,16)(H,17,18)
InChIKeyJOISVDGNQSFPCA-UHFFFAOYSA-N
XLogP1.50
TPSA116.22 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.21
LogP ≤ 51.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid (CID 107369142) is 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid is N#Cc1ccccc1NC(=O)c1cc(C(=O)O)on1.
What is the InChIKey of 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The InChIKey is JOISVDGNQSFPCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O4/c13-6-7-3-1-2-4-8(7)14-11(16)9-5-10(12(17)18)19-15-9/h1-5H,(H,14,16)(H,17,18).
What are the key properties of 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid has a molecular weight of 257.21 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-cyanophenyl)carbamoyl]-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 107369142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).