3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid

C9H12N2O6 — CID 107369276

IUPAC3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)c1cc(C(=O)N(CCO)CCO)no1
InChIInChI=1S/C9H12N2O6/c12-3-1-11(2-4-13)8(14)6-5-7(9(15)16)17-10-6/h5,12-13H,1-4H2,(H,15,16)
InChIKeyDCKPATWRQNHYBY-UHFFFAOYSA-N
MW244.20 g/mol
LogP-1.20
Rot. Bonds6

About 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid

3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 107369276) has the molecular formula C9H12N2O6 and a molecular weight of 244.20 g/mol. Its IUPAC name is 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
PubChem CID107369276
Molecular FormulaC9H12N2O6
Molecular Weight244.20 g/mol
Exact Mass244.07
IUPAC Name3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid
SMILESO=C(O)c1cc(C(=O)N(CCO)CCO)no1
InChIInChI=1S/C9H12N2O6/c12-3-1-11(2-4-13)8(14)6-5-7(9(15)16)17-10-6/h5,12-13H,1-4H2,(H,15,16)
InChIKeyDCKPATWRQNHYBY-UHFFFAOYSA-N
XLogP-1.20
TPSA124.10 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.20
LogP ≤ 5-1.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid (CID 107369276) is 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid is O=C(O)c1cc(C(=O)N(CCO)CCO)no1.
What is the InChIKey of 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
The InChIKey is DCKPATWRQNHYBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O6/c12-3-1-11(2-4-13)8(14)6-5-7(9(15)16)17-10-6/h5,12-13H,1-4H2,(H,15,16).
What are the key properties of 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid?
3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid has a molecular weight of 244.20 g/mol, XLogP of -1.20, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(2-hydroxyethyl)carbamoyl]-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 107369276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).