C14H14N2O5 — CID 107369462
3-[2-(3-methylphenoxy)ethylcarbamoyl]-1,2-oxazole-5-carboxylic acid (PubChem CID 107369462) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-[2-(3-methylphenoxy)ethylcarbamoyl]-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-[2-(3-methylphenoxy)ethylcarbamoyl]-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107369462 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-[2-(3-methylphenoxy)ethylcarbamoyl]-1,2-oxazole-5-carboxylic acid |
| SMILES | Cc1cccc(OCCNC(=O)c2cc(C(=O)O)on2)c1 |
| InChI | InChI=1S/C14H14N2O5/c1-9-3-2-4-10(7-9)20-6-5-15-13(17)11-8-12(14(18)19)21-16-11/h2-4,7-8H,5-6H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | ZBOCDGBSCJHAFC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|