C10H12N2O4 — CID 107369962
3-(pent-4-en-2-ylcarbamoyl)-1,2-oxazole-5-carboxylic acid (PubChem CID 107369962) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 3-(pent-4-en-2-ylcarbamoyl)-1,2-oxazole-5-carboxylic acid.
| Compound Name | 3-(pent-4-en-2-ylcarbamoyl)-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107369962 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-(pent-4-en-2-ylcarbamoyl)-1,2-oxazole-5-carboxylic acid |
| SMILES | C=CCC(C)NC(=O)c1cc(C(=O)O)on1 |
| InChI | InChI=1S/C10H12N2O4/c1-3-4-6(2)11-9(13)7-5-8(10(14)15)16-12-7/h3,5-6H,1,4H2,2H3,(H,11,13)(H,14,15) |
| InChIKey | IVWCHKBRIWNHRO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|