C18H24N2O2Si2 — CID 10737009
1,7-dimethyl-2,6-bis(2-trimethylsilylethynyl)pyrazolo[1,2-a]pyrazole-3,5-dione (PubChem CID 10737009) has the molecular formula C18H24N2O2Si2 and a molecular weight of 356.57 g/mol. Its IUPAC name is 1,7-dimethyl-2,6-bis(2-trimethylsilylethynyl)pyrazolo[1,2-a]pyrazole-3,5-dione.
| Compound Name | 1,7-dimethyl-2,6-bis(2-trimethylsilylethynyl)pyrazolo[1,2-a]pyrazole-3,5-dione |
|---|---|
| PubChem CID | 10737009 |
| Molecular Formula | C18H24N2O2Si2 |
| Molecular Weight | 356.57 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1,7-dimethyl-2,6-bis(2-trimethylsilylethynyl)pyrazolo[1,2-a]pyrazole-3,5-dione |
| SMILES | Cc1c(C#C[Si](C)(C)C)c(=O)n2c(=O)c(C#C[Si](C)(C)C)c(C)n12 |
| InChI | InChI=1S/C18H24N2O2Si2/c1-13-15(9-11-23(3,4)5)17(21)20-18(22)16(14(2)19(13)20)10-12-24(6,7)8/h1-8H3 |
| InChIKey | OAMUNIZLYLKFFU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 42.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|