C19H36O4Si — CID 10737010
[3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,2-trimethylcyclopentyl]-3-oxopropyl] acetate (PubChem CID 10737010) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is [3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,2-trimethylcyclopentyl]-3-oxopropyl] acetate.
| Compound Name | [3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,2-trimethylcyclopentyl]-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 10737010 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | [3-[(1R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-1,2,2-trimethylcyclopentyl]-3-oxopropyl] acetate |
| SMILES | CC(=O)OCCC(=O)[C@]1(C)C[C@@H](O[Si](C)(C)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-14(20)22-11-10-16(21)19(7)13-15(12-18(19,5)6)23-24(8,9)17(2,3)4/h15H,10-13H2,1-9H3/t15-,19-/m0/s1 |
| InChIKey | QCLLHFMCOWDTMK-KXBFYZLASA-N |
| XLogP | 4.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|