C15H15ClFN3O — CID 107370312
1-[4-(1-aminoethyl)phenyl]-3-(3-chloro-5-fluorophenyl)urea (PubChem CID 107370312) has the molecular formula C15H15ClFN3O and a molecular weight of 307.76 g/mol. Its IUPAC name is 1-[4-(1-aminoethyl)phenyl]-3-(3-chloro-5-fluorophenyl)urea.
| Compound Name | 1-[4-(1-aminoethyl)phenyl]-3-(3-chloro-5-fluorophenyl)urea |
|---|---|
| PubChem CID | 107370312 |
| Molecular Formula | C15H15ClFN3O |
| Molecular Weight | 307.76 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1-[4-(1-aminoethyl)phenyl]-3-(3-chloro-5-fluorophenyl)urea |
| SMILES | CC(N)c1ccc(NC(=O)Nc2cc(F)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H15ClFN3O/c1-9(18)10-2-4-13(5-3-10)19-15(21)20-14-7-11(16)6-12(17)8-14/h2-9H,18H2,1H3,(H2,19,20,21) |
| InChIKey | NTGONWAQPOYVKM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |