C21H27NO4 — CID 10737048
(1R,4S,5R,8S,12R,13S)-11-benzyl-1,5-dimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (PubChem CID 10737048) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (1R,4S,5R,8S,12R,13S)-11-benzyl-1,5-dimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one.
| Compound Name | (1R,4S,5R,8S,12R,13S)-11-benzyl-1,5-dimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
|---|---|
| PubChem CID | 10737048 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (1R,4S,5R,8S,12R,13S)-11-benzyl-1,5-dimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| SMILES | C[C@@H]1CC[C@H]2CC(=O)N(Cc3ccccc3)[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C21H27NO4/c1-14-8-9-16-12-18(23)22(13-15-6-4-3-5-7-15)19-21(16)17(14)10-11-20(2,24-19)25-26-21/h3-7,14,16-17,19H,8-13H2,1-2H3/t14-,16+,17+,19-,20-,21+/m1/s1 |
| InChIKey | UPDJPXJSQCFMLW-CQAWWZBVSA-N |
| XLogP | 3.63 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|