C13H13ClFN3 — CID 107370632
(8-chloro-6-fluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine (PubChem CID 107370632) has the molecular formula C13H13ClFN3 and a molecular weight of 265.72 g/mol. Its IUPAC name is (8-chloro-6-fluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine.
| Compound Name | (8-chloro-6-fluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
|---|---|
| PubChem CID | 107370632 |
| Molecular Formula | C13H13ClFN3 |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | (8-chloro-6-fluoro-1,2,3,4-tetrahydroacridin-9-yl)hydrazine |
| SMILES | NNc1c2c(nc3cc(F)cc(Cl)c13)CCCC2 |
| InChI | InChI=1S/C13H13ClFN3/c14-9-5-7(15)6-11-12(9)13(18-16)8-3-1-2-4-10(8)17-11/h5-6H,1-4,16H2,(H,17,18) |
| InChIKey | MAXYVIMDJPYXEY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|