C16H22ClFN2 — CID 107370684
9-(3-chloro-5-fluorophenyl)-N-ethyl-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 107370684) has the molecular formula C16H22ClFN2 and a molecular weight of 296.82 g/mol. Its IUPAC name is 9-(3-chloro-5-fluorophenyl)-N-ethyl-9-azabicyclo[3.3.1]nonan-3-amine.
| Compound Name | 9-(3-chloro-5-fluorophenyl)-N-ethyl-9-azabicyclo[3.3.1]nonan-3-amine |
|---|---|
| PubChem CID | 107370684 |
| Molecular Formula | C16H22ClFN2 |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 9-(3-chloro-5-fluorophenyl)-N-ethyl-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | CCNC1CC2CCCC(C1)N2c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C16H22ClFN2/c1-2-19-13-9-14-4-3-5-15(10-13)20(14)16-7-11(17)6-12(18)8-16/h6-8,13-15,19H,2-5,9-10H2,1H3 |
| InChIKey | KEVFPUURDKTBNC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |