C25H26O2 — CID 10737120
(8R,9S,10R,13S,14S)-10,13-dimethyl-6-phenyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 10737120) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-6-phenyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-6-phenyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 10737120 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-6-phenyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12C=CC(=O)C=C1C(c1ccccc1)=C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C25H26O2/c1-24-12-10-17(26)14-22(24)18(16-6-4-3-5-7-16)15-19-20-8-9-23(27)25(20,2)13-11-21(19)24/h3-7,10,12,14-15,19-21H,8-9,11,13H2,1-2H3/t19-,20-,21-,24+,25-/m0/s1 |
| InChIKey | WEDHPTACEOKKBX-UFYKXHCUSA-N |
| XLogP | 5.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |