C11H13ClFN7 — CID 107371206
2-N-(3-chloro-5-fluorophenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 107371206) has the molecular formula C11H13ClFN7 and a molecular weight of 297.73 g/mol. Its IUPAC name is 2-N-(3-chloro-5-fluorophenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-chloro-5-fluorophenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 107371206 |
| Molecular Formula | C11H13ClFN7 |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-N-(3-chloro-5-fluorophenyl)-6-hydrazinyl-4-N,4-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(NN)nc(Nc2cc(F)cc(Cl)c2)n1 |
| InChI | InChI=1S/C11H13ClFN7/c1-20(2)11-17-9(16-10(18-11)19-14)15-8-4-6(12)3-7(13)5-8/h3-5H,14H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | IPXUTSMEXUYRKA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|