C23H36O3 — CID 10737271
methyl (E)-6-hydroxy-8-(3-pentyl-3a,4,7,7a-tetrahydro-1H-inden-2-yl)oct-7-enoate (PubChem CID 10737271) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is methyl (E)-6-hydroxy-8-(3-pentyl-3a,4,7,7a-tetrahydro-1H-inden-2-yl)oct-7-enoate.
| Compound Name | methyl (E)-6-hydroxy-8-(3-pentyl-3a,4,7,7a-tetrahydro-1H-inden-2-yl)oct-7-enoate |
|---|---|
| PubChem CID | 10737271 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | methyl (E)-6-hydroxy-8-(3-pentyl-3a,4,7,7a-tetrahydro-1H-inden-2-yl)oct-7-enoate |
| SMILES | CCCCCC1=C(/C=C/C(O)CCCCC(=O)OC)CC2CC=CCC12 |
| InChI | InChI=1S/C23H36O3/c1-3-4-5-12-22-19(17-18-10-6-8-13-21(18)22)15-16-20(24)11-7-9-14-23(25)26-2/h6,8,15-16,18,20-21,24H,3-5,7,9-14,17H2,1-2H3/b16-15+ |
| InChIKey | NTMFJUDPMDAETC-FOCLMDBBSA-N |
| XLogP | 5.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|