About [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol
[5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol (PubChem CID 107372980) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol |
| PubChem CID | 107372980 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol |
| SMILES | OCc1cnc(N2CC=CCC2)cn1 |
| InChI | InChI=1S/C10H13N3O/c14-8-9-6-12-10(7-11-9)13-4-2-1-3-5-13/h1-2,6-7,14H,3-5,8H2 |
| InChIKey | SXEQWUBYJSRFOU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol?
The IUPAC name of [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol (CID 107372980) is [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol.
What is the SMILES notation for [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol?
The canonical SMILES for [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol is OCc1cnc(N2CC=CCC2)cn1.
What is the InChIKey of [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol?
The InChIKey is SXEQWUBYJSRFOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c14-8-9-6-12-10(7-11-9)13-4-2-1-3-5-13/h1-2,6-7,14H,3-5,8H2.
What are the key properties of [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol?
[5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol has a molecular weight of 191.23 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(3,6-dihydro-2H-pyridin-1-yl)pyrazin-2-yl]methanol is sourced from PubChem (CID 107372980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).