C21H31NO4 — CID 10737312
tert-butyl N-benzyl-N-[(1S)-3-methyl-1-[(2S)-5-oxooxolan-2-yl]butyl]carbamate (PubChem CID 10737312) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(1S)-3-methyl-1-[(2S)-5-oxooxolan-2-yl]butyl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(1S)-3-methyl-1-[(2S)-5-oxooxolan-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 10737312 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | tert-butyl N-benzyl-N-[(1S)-3-methyl-1-[(2S)-5-oxooxolan-2-yl]butyl]carbamate |
| SMILES | CC(C)C[C@@H]([C@@H]1CCC(=O)O1)N(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31NO4/c1-15(2)13-17(18-11-12-19(23)25-18)22(20(24)26-21(3,4)5)14-16-9-7-6-8-10-16/h6-10,15,17-18H,11-14H2,1-5H3/t17-,18-/m0/s1 |
| InChIKey | GYZUMCDNMVEQBG-ROUUACIJSA-N |
| XLogP | 4.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |