C8H9F3N2O2 — CID 107373209
[5-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methanol (PubChem CID 107373209) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is [5-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methanol.
| Compound Name | [5-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methanol |
|---|---|
| PubChem CID | 107373209 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | [5-(1,1,1-trifluoropropan-2-yloxy)pyrazin-2-yl]methanol |
| SMILES | CC(Oc1cnc(CO)cn1)C(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O2/c1-5(8(9,10)11)15-7-3-12-6(4-14)2-13-7/h2-3,5,14H,4H2,1H3 |
| InChIKey | GZBHBGCUYIWDBU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |