About [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol
[5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol (PubChem CID 107373257) has the molecular formula C8H9N5O2
and a molecular weight of 207.19 g/mol. Its IUPAC name is [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol |
| PubChem CID | 107373257 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol |
| SMILES | Cn1cnc(Oc2cnc(CO)cn2)n1 |
| InChI | InChI=1S/C8H9N5O2/c1-13-5-11-8(12-13)15-7-3-9-6(4-14)2-10-7/h2-3,5,14H,4H2,1H3 |
| InChIKey | UADHPFMLIODCSF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol?
The IUPAC name of [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol (CID 107373257) is [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol.
What is the SMILES notation for [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol?
The canonical SMILES for [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol is Cn1cnc(Oc2cnc(CO)cn2)n1.
What is the InChIKey of [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol?
The InChIKey is UADHPFMLIODCSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O2/c1-13-5-11-8(12-13)15-7-3-9-6(4-14)2-10-7/h2-3,5,14H,4H2,1H3.
What are the key properties of [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol?
[5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol has a molecular weight of 207.19 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(1-methyl-1,2,4-triazol-3-yl)oxy]pyrazin-2-yl]methanol is sourced from PubChem (CID 107373257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).