C23H22O4 — CID 10737359
8-[(4-hydroxyphenyl)methyl]-5,7-dimethoxy-9,10-dihydrophenanthren-2-ol (PubChem CID 10737359) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 8-[(4-hydroxyphenyl)methyl]-5,7-dimethoxy-9,10-dihydrophenanthren-2-ol.
| Compound Name | 8-[(4-hydroxyphenyl)methyl]-5,7-dimethoxy-9,10-dihydrophenanthren-2-ol |
|---|---|
| PubChem CID | 10737359 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 8-[(4-hydroxyphenyl)methyl]-5,7-dimethoxy-9,10-dihydrophenanthren-2-ol |
| SMILES | COc1cc(OC)c2c(c1Cc1ccc(O)cc1)CCc1cc(O)ccc1-2 |
| InChI | InChI=1S/C23H22O4/c1-26-21-13-22(27-2)23-18-10-8-17(25)12-15(18)5-9-19(23)20(21)11-14-3-6-16(24)7-4-14/h3-4,6-8,10,12-13,24-25H,5,9,11H2,1-2H3 |
| InChIKey | GNRQSQCPDZCLSO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |