C14H23N5O — CID 107374811
5-(methylamino)-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]pyrazine-2-carboxamide (PubChem CID 107374811) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-(methylamino)-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]pyrazine-2-carboxamide.
| Compound Name | 5-(methylamino)-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107374811 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 5-(methylamino)-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]pyrazine-2-carboxamide |
| SMILES | CNc1cnc(C(=O)NCC2CCN(C(C)C)C2)cn1 |
| InChI | InChI=1S/C14H23N5O/c1-10(2)19-5-4-11(9-19)6-18-14(20)12-7-17-13(15-3)8-16-12/h7-8,10-11H,4-6,9H2,1-3H3,(H,15,17)(H,18,20) |
| InChIKey | PYMLYIFBXSXEBD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |