C13H20N4O2 — CID 107375030
N-cyclopentyl-N-(2-hydroxyethyl)-5-(methylamino)pyrazine-2-carboxamide (PubChem CID 107375030) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-cyclopentyl-N-(2-hydroxyethyl)-5-(methylamino)pyrazine-2-carboxamide.
| Compound Name | N-cyclopentyl-N-(2-hydroxyethyl)-5-(methylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107375030 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-cyclopentyl-N-(2-hydroxyethyl)-5-(methylamino)pyrazine-2-carboxamide |
| SMILES | CNc1cnc(C(=O)N(CCO)C2CCCC2)cn1 |
| InChI | InChI=1S/C13H20N4O2/c1-14-12-9-15-11(8-16-12)13(19)17(6-7-18)10-4-2-3-5-10/h8-10,18H,2-7H2,1H3,(H,14,16) |
| InChIKey | ZXSMFRUJERQZSI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |