C15H23N5O — CID 107375576
1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl-[5-(ethylamino)pyrazin-2-yl]methanone (PubChem CID 107375576) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl-[5-(ethylamino)pyrazin-2-yl]methanone.
| Compound Name | 1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl-[5-(ethylamino)pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 107375576 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl-[5-(ethylamino)pyrazin-2-yl]methanone |
| SMILES | CCNc1cnc(C(=O)N2CCCN3CCCC3C2)cn1 |
| InChI | InChI=1S/C15H23N5O/c1-2-16-14-10-17-13(9-18-14)15(21)20-8-4-7-19-6-3-5-12(19)11-20/h9-10,12H,2-8,11H2,1H3,(H,16,18) |
| InChIKey | WVHYYJNMPNFZKW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |