C12H11ClN4O — CID 107376052
5-amino-N-(2-chloro-6-methylphenyl)pyrazine-2-carboxamide (PubChem CID 107376052) has the molecular formula C12H11ClN4O and a molecular weight of 262.70 g/mol. Its IUPAC name is 5-amino-N-(2-chloro-6-methylphenyl)pyrazine-2-carboxamide.
| Compound Name | 5-amino-N-(2-chloro-6-methylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107376052 |
| Molecular Formula | C12H11ClN4O |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 5-amino-N-(2-chloro-6-methylphenyl)pyrazine-2-carboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)c1cnc(N)cn1 |
| InChI | InChI=1S/C12H11ClN4O/c1-7-3-2-4-8(13)11(7)17-12(18)9-5-16-10(14)6-15-9/h2-6H,1H3,(H2,14,16)(H,17,18) |
| InChIKey | BDBBGRNNZTYEHA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |