C22H25NO4 — CID 10737705
3-hydroxy-6-(methoxymethoxy)-2-methyl-3-(2-phenylethyl)-5-prop-2-enylisoindol-1-one (PubChem CID 10737705) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-hydroxy-6-(methoxymethoxy)-2-methyl-3-(2-phenylethyl)-5-prop-2-enylisoindol-1-one.
| Compound Name | 3-hydroxy-6-(methoxymethoxy)-2-methyl-3-(2-phenylethyl)-5-prop-2-enylisoindol-1-one |
|---|---|
| PubChem CID | 10737705 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-hydroxy-6-(methoxymethoxy)-2-methyl-3-(2-phenylethyl)-5-prop-2-enylisoindol-1-one |
| SMILES | C=CCc1cc2c(cc1OCOC)C(=O)N(C)C2(O)CCc1ccccc1 |
| InChI | InChI=1S/C22H25NO4/c1-4-8-17-13-19-18(14-20(17)27-15-26-3)21(24)23(2)22(19,25)12-11-16-9-6-5-7-10-16/h4-7,9-10,13-14,25H,1,8,11-12,15H2,2-3H3 |
| InChIKey | XUNSVVURHAMFOC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|