C22H25Br — CID 10737801
16-[(E)-2-bromoethenyl]-6-tert-butyltricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene (PubChem CID 10737801) has the molecular formula C22H25Br and a molecular weight of 369.35 g/mol. Its IUPAC name is 16-[(E)-2-bromoethenyl]-6-tert-butyltricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene.
| Compound Name | 16-[(E)-2-bromoethenyl]-6-tert-butyltricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene |
|---|---|
| PubChem CID | 10737801 |
| Molecular Formula | C22H25Br |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 16-[(E)-2-bromoethenyl]-6-tert-butyltricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene |
| SMILES | CC(C)(C)c1cc2c(/C=C/Br)c(c1)CCc1cccc(c1)CC2 |
| InChI | InChI=1S/C22H25Br/c1-22(2,3)20-14-18-9-7-16-5-4-6-17(13-16)8-10-19(15-20)21(18)11-12-23/h4-6,11-15H,7-10H2,1-3H3/b12-11+ |
| InChIKey | QFBHCCUWLXIMSR-VAWYXSNFSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |