C19H23N5OS — CID 10737848
1-pyrrolidin-1-yl-2-[4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazin-1-yl]ethanone (PubChem CID 10737848) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-2-[4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-pyrrolidin-1-yl-2-[4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 10737848 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-pyrrolidin-1-yl-2-[4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(c2nc3ccsc3n3cccc23)CC1)N1CCCC1 |
| InChI | InChI=1S/C19H23N5OS/c25-17(22-6-1-2-7-22)14-21-9-11-23(12-10-21)18-16-4-3-8-24(16)19-15(20-18)5-13-26-19/h3-5,8,13H,1-2,6-7,9-12,14H2 |
| InChIKey | BGPSOKRQZWMDEI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 44.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |