C19H18N2O6 — CID 10737882
2-[[5-[3-(3-methylphenyl)-3-oxoprop-1-ynyl]-2,4-dioxopyrimidin-1-yl]methoxy]ethyl acetate (PubChem CID 10737882) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is 2-[[5-[3-(3-methylphenyl)-3-oxoprop-1-ynyl]-2,4-dioxopyrimidin-1-yl]methoxy]ethyl acetate.
| Compound Name | 2-[[5-[3-(3-methylphenyl)-3-oxoprop-1-ynyl]-2,4-dioxopyrimidin-1-yl]methoxy]ethyl acetate |
|---|---|
| PubChem CID | 10737882 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-[[5-[3-(3-methylphenyl)-3-oxoprop-1-ynyl]-2,4-dioxopyrimidin-1-yl]methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCn1cc(C#CC(=O)c2cccc(C)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H18N2O6/c1-13-4-3-5-15(10-13)17(23)7-6-16-11-21(19(25)20-18(16)24)12-26-8-9-27-14(2)22/h3-5,10-11H,8-9,12H2,1-2H3,(H,20,24,25) |
| InChIKey | LOIYBTXTLCFTCX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|