C15H19BrN4 — CID 107379580
N-[(2-bromophenyl)methyl]-5-(ethylaminomethyl)-N-methylpyrazin-2-amine (PubChem CID 107379580) has the molecular formula C15H19BrN4 and a molecular weight of 335.25 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-5-(ethylaminomethyl)-N-methylpyrazin-2-amine.
| Compound Name | N-[(2-bromophenyl)methyl]-5-(ethylaminomethyl)-N-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 107379580 |
| Molecular Formula | C15H19BrN4 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-5-(ethylaminomethyl)-N-methylpyrazin-2-amine |
| SMILES | CCNCc1cnc(N(C)Cc2ccccc2Br)cn1 |
| InChI | InChI=1S/C15H19BrN4/c1-3-17-8-13-9-19-15(10-18-13)20(2)11-12-6-4-5-7-14(12)16/h4-7,9-10,17H,3,8,11H2,1-2H3 |
| InChIKey | OBPZTMASYVRGSG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |