C16H21FN4 — CID 107379672
N-(3-fluorophenyl)-N-methyl-5-[(2-methylpropylamino)methyl]pyrazin-2-amine (PubChem CID 107379672) has the molecular formula C16H21FN4 and a molecular weight of 288.37 g/mol. Its IUPAC name is N-(3-fluorophenyl)-N-methyl-5-[(2-methylpropylamino)methyl]pyrazin-2-amine.
| Compound Name | N-(3-fluorophenyl)-N-methyl-5-[(2-methylpropylamino)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 107379672 |
| Molecular Formula | C16H21FN4 |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-(3-fluorophenyl)-N-methyl-5-[(2-methylpropylamino)methyl]pyrazin-2-amine |
| SMILES | CC(C)CNCc1cnc(N(C)c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C16H21FN4/c1-12(2)8-18-9-14-10-20-16(11-19-14)21(3)15-6-4-5-13(17)7-15/h4-7,10-12,18H,8-9H2,1-3H3 |
| InChIKey | IWEPIRYSBQFZSC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |