C18H33NO5Si — CID 10737995
dimethyl (1S,2S,3S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylamino)cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 10737995) has the molecular formula C18H33NO5Si and a molecular weight of 371.55 g/mol. Its IUPAC name is dimethyl (1S,2S,3S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylamino)cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylamino)cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10737995 |
| Molecular Formula | C18H33NO5Si |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | dimethyl (1S,2S,3S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(dimethylamino)cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](C(=O)OC)CC(O[Si](C)(C)C(C)(C)C)=C[C@@H]1N(C)C |
| InChI | InChI=1S/C18H33NO5Si/c1-18(2,3)25(8,9)24-12-10-13(16(20)22-6)15(17(21)23-7)14(11-12)19(4)5/h11,13-15H,10H2,1-9H3/t13-,14-,15-/m0/s1 |
| InChIKey | KIMUFSXCAARBNQ-KKUMJFAQSA-N |
| XLogP | 2.80 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|