About 1,1-diphenylhydrazine;hydrochloride
1,1-diphenylhydrazine;hydrochloride (PubChem CID 10738) has the molecular formula C12H13ClN2
and a molecular weight of 220.70 g/mol. Its IUPAC name is 1,1-diphenylhydrazine;hydrochloride.
Molecular Properties
| Compound Name | 1,1-diphenylhydrazine;hydrochloride |
| PubChem CID | 10738 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1,1-diphenylhydrazine;hydrochloride |
| SMILES | Cl.NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H12N2.ClH/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,13H2;1H |
| InChIKey | MIVUDWFNUOXEJM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diphenylhydrazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diphenylhydrazine;hydrochloride?
The IUPAC name of 1,1-diphenylhydrazine;hydrochloride (CID 10738) is 1,1-diphenylhydrazine;hydrochloride.
What is the SMILES notation for 1,1-diphenylhydrazine;hydrochloride?
The canonical SMILES for 1,1-diphenylhydrazine;hydrochloride is Cl.NN(c1ccccc1)c1ccccc1.
What is the InChIKey of 1,1-diphenylhydrazine;hydrochloride?
The InChIKey is MIVUDWFNUOXEJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.ClH/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10H,13H2;1H.
What are the key properties of 1,1-diphenylhydrazine;hydrochloride?
1,1-diphenylhydrazine;hydrochloride has a molecular weight of 220.70 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diphenylhydrazine;hydrochloride is sourced from PubChem (CID 10738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).