About 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine
1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine (PubChem CID 107380160) has the molecular formula C15H18N4O
and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine |
| PubChem CID | 107380160 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine |
| SMILES | CNCc1cnc(N2CCOc3ccccc3C2)cn1 |
| InChI | InChI=1S/C15H18N4O/c1-16-8-13-9-18-15(10-17-13)19-6-7-20-14-5-3-2-4-12(14)11-19/h2-5,9-10,16H,6-8,11H2,1H3 |
| InChIKey | XUQOYOKPDGRDNI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine?
The IUPAC name of 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine (CID 107380160) is 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine.
What is the SMILES notation for 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine?
The canonical SMILES for 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine is CNCc1cnc(N2CCOc3ccccc3C2)cn1.
What is the InChIKey of 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine?
The InChIKey is XUQOYOKPDGRDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N4O/c1-16-8-13-9-18-15(10-17-13)19-6-7-20-14-5-3-2-4-12(14)11-19/h2-5,9-10,16H,6-8,11H2,1H3.
What are the key properties of 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine?
1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine has a molecular weight of 270.34 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)pyrazin-2-yl]-N-methylmethanamine is sourced from PubChem (CID 107380160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).