C20H20O5S — CID 10738044
[(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]methanol (PubChem CID 10738044) has the molecular formula C20H20O5S and a molecular weight of 372.44 g/mol. Its IUPAC name is [(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]methanol.
| Compound Name | [(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]methanol |
|---|---|
| PubChem CID | 10738044 |
| Molecular Formula | C20H20O5S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [(1R,4S,6R,9S)-5-(benzenesulfonyl)-14,15-dioxapentacyclo[7.3.1.11,4.16,9.05,13]pentadeca-2,7-dien-13-yl]methanol |
| SMILES | O=S(=O)(c1ccccc1)C12[C@@H]3C=C[C@@]4(CCC[C@]5(C=C[C@H]1O5)C24CO)O3 |
| InChI | InChI=1S/C20H20O5S/c21-13-19-17-9-4-10-18(19)12-8-16(25-18)20(19,15(24-17)7-11-17)26(22,23)14-5-2-1-3-6-14/h1-3,5-8,11-12,15-16,21H,4,9-10,13H2/t15-,16+,17+,18-,19?,20? |
| InChIKey | GWRIETHYHHTQBZ-MFVSGWCXSA-N |
| XLogP | 1.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|