About trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane
trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane (PubChem CID 10738077) has the molecular formula C18H44Si4
and a molecular weight of 372.89 g/mol. Its IUPAC name is trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane.
Molecular Properties
| Compound Name | trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane |
| PubChem CID | 10738077 |
| Molecular Formula | C18H44Si4 |
| Molecular Weight | 372.89 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane |
| SMILES | CC(/C=C/C(C)([Si](C)(C)C)[Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C18H44Si4/c1-17(19(3,4)5,20(6,7)8)15-16-18(2,21(9,10)11)22(12,13)14/h15-16H,1-14H3/b16-15+ |
| InChIKey | LREGXOSZBPAEKS-FOCLMDBBSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.89 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane?
The IUPAC name of trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane (CID 10738077) is trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane.
What is the SMILES notation for trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane?
The canonical SMILES for trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane is CC(/C=C/C(C)([Si](C)(C)C)[Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane?
The InChIKey is LREGXOSZBPAEKS-FOCLMDBBSA-N. The full InChI is InChI=1S/C18H44Si4/c1-17(19(3,4)5,20(6,7)8)15-16-18(2,21(9,10)11)22(12,13)14/h15-16H,1-14H3/b16-15+.
What are the key properties of trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane?
trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane has a molecular weight of 372.89 g/mol, XLogP of 7.49, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(E)-2,5,5-tris(trimethylsilyl)hex-3-en-2-yl]silane is sourced from PubChem (CID 10738077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).