C10H13N5 — CID 107381116
N-[(5-pyrazol-1-ylpyrazin-2-yl)methyl]ethanamine (PubChem CID 107381116) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is N-[(5-pyrazol-1-ylpyrazin-2-yl)methyl]ethanamine.
| Compound Name | N-[(5-pyrazol-1-ylpyrazin-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107381116 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-[(5-pyrazol-1-ylpyrazin-2-yl)methyl]ethanamine |
| SMILES | CCNCc1cnc(-n2cccn2)cn1 |
| InChI | InChI=1S/C10H13N5/c1-2-11-6-9-7-13-10(8-12-9)15-5-3-4-14-15/h3-5,7-8,11H,2,6H2,1H3 |
| InChIKey | MYKQBFGNWXRQHI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |