C21H26O6 — CID 10738169
(4R,7S,10E,13S)-7-ethoxy-11-methyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),10-diene-3,6,9,15-tetrone (PubChem CID 10738169) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (4R,7S,10E,13S)-7-ethoxy-11-methyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),10-diene-3,6,9,15-tetrone.
| Compound Name | (4R,7S,10E,13S)-7-ethoxy-11-methyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),10-diene-3,6,9,15-tetrone |
|---|---|
| PubChem CID | 10738169 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (4R,7S,10E,13S)-7-ethoxy-11-methyl-4-prop-1-en-2-yl-14-oxabicyclo[11.2.1]hexadeca-1(16),10-diene-3,6,9,15-tetrone |
| SMILES | C=C(C)[C@H]1CC(=O)[C@@H](OCC)CC(=O)/C=C(\C)C[C@H]2C=C(CC1=O)C(=O)O2 |
| InChI | InChI=1S/C21H26O6/c1-5-26-20-10-15(22)6-13(4)7-16-8-14(21(25)27-16)9-18(23)17(12(2)3)11-19(20)24/h6,8,16-17,20H,2,5,7,9-11H2,1,3-4H3/b13-6+/t16-,17+,20-/m0/s1 |
| InChIKey | ALTRNXWGUQFXSC-UNNYLJGKSA-N |
| XLogP | 2.66 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|