About N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine
N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine (PubChem CID 107382313) has the molecular formula C17H27N3O
and a molecular weight of 289.42 g/mol. Its IUPAC name is N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine |
| PubChem CID | 107382313 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine |
| SMILES | CCNCc1cnc(OC2CC3CCC2(C)C3(C)C)cn1 |
| InChI | InChI=1S/C17H27N3O/c1-5-18-9-13-10-20-15(11-19-13)21-14-8-12-6-7-17(14,4)16(12,2)3/h10-12,14,18H,5-9H2,1-4H3 |
| InChIKey | JKHCCIVRXKRDBN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine?
The IUPAC name of N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine (CID 107382313) is N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine.
What is the SMILES notation for N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine?
The canonical SMILES for N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine is CCNCc1cnc(OC2CC3CCC2(C)C3(C)C)cn1.
What is the InChIKey of N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine?
The InChIKey is JKHCCIVRXKRDBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O/c1-5-18-9-13-10-20-15(11-19-13)21-14-8-12-6-7-17(14,4)16(12,2)3/h10-12,14,18H,5-9H2,1-4H3.
What are the key properties of N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine?
N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine has a molecular weight of 289.42 g/mol, XLogP of 3.18, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyrazin-2-yl]methyl]ethanamine is sourced from PubChem (CID 107382313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).