C15H24N2O — CID 107383499
3-[(1,3-diethylpyrazol-5-yl)methyl]cyclohept-2-en-1-ol (PubChem CID 107383499) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-[(1,3-diethylpyrazol-5-yl)methyl]cyclohept-2-en-1-ol.
| Compound Name | 3-[(1,3-diethylpyrazol-5-yl)methyl]cyclohept-2-en-1-ol |
|---|---|
| PubChem CID | 107383499 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3-[(1,3-diethylpyrazol-5-yl)methyl]cyclohept-2-en-1-ol |
| SMILES | CCc1cc(CC2=CC(O)CCCC2)n(CC)n1 |
| InChI | InChI=1S/C15H24N2O/c1-3-13-11-14(17(4-2)16-13)9-12-7-5-6-8-15(18)10-12/h10-11,15,18H,3-9H2,1-2H3 |
| InChIKey | MJCJDRJQFLNHBT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|