C23H32O3Si — CID 10738822
(2S,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanal (PubChem CID 10738822) has the molecular formula C23H32O3Si and a molecular weight of 384.59 g/mol. Its IUPAC name is (2S,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanal.
| Compound Name | (2S,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanal |
|---|---|
| PubChem CID | 10738822 |
| Molecular Formula | C23H32O3Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | (2S,3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2,4-dimethylpentanal |
| SMILES | C[C@H](C=O)[C@@H](O)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H32O3Si/c1-18(16-24)22(25)19(2)17-26-27(23(3,4)5,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-16,18-19,22,25H,17H2,1-5H3/t18-,19-,22-/m1/s1 |
| InChIKey | CLTHRKKKATWQAX-WOIUINJBSA-N |
| XLogP | 3.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|