C18H20ClNO — CID 107388327
3-(3-chlorospiro[3.5]nonan-1-yl)oxyquinoline (PubChem CID 107388327) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is 3-(3-chlorospiro[3.5]nonan-1-yl)oxyquinoline.
| Compound Name | 3-(3-chlorospiro[3.5]nonan-1-yl)oxyquinoline |
|---|---|
| PubChem CID | 107388327 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-(3-chlorospiro[3.5]nonan-1-yl)oxyquinoline |
| SMILES | ClC1CC(Oc2cnc3ccccc3c2)C12CCCCC2 |
| InChI | InChI=1S/C18H20ClNO/c19-16-11-17(18(16)8-4-1-5-9-18)21-14-10-13-6-2-3-7-15(13)20-12-14/h2-3,6-7,10,12,16-17H,1,4-5,8-9,11H2 |
| InChIKey | DEIQWIOYSXETKR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|